C12H13NO5S — CID 113382365
1-(2-methylsulfonylacetyl)-2,3-dihydroindole-6-carboxylic acid (PubChem CID 113382365) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(2-methylsulfonylacetyl)-2,3-dihydroindole-6-carboxylic acid.
| Compound Name | 1-(2-methylsulfonylacetyl)-2,3-dihydroindole-6-carboxylic acid |
|---|---|
| PubChem CID | 113382365 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-(2-methylsulfonylacetyl)-2,3-dihydroindole-6-carboxylic acid |
| SMILES | CS(=O)(=O)CC(=O)N1CCc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C12H13NO5S/c1-19(17,18)7-11(14)13-5-4-8-2-3-9(12(15)16)6-10(8)13/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | LCSMEEDHLNSMKI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |