C10H12N2O4S — CID 114807060
1-(methylsulfamoyl)-2,3-dihydroindole-6-carboxylic acid (PubChem CID 114807060) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 1-(methylsulfamoyl)-2,3-dihydroindole-6-carboxylic acid.
| Compound Name | 1-(methylsulfamoyl)-2,3-dihydroindole-6-carboxylic acid |
|---|---|
| PubChem CID | 114807060 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-(methylsulfamoyl)-2,3-dihydroindole-6-carboxylic acid |
| SMILES | CNS(=O)(=O)N1CCc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C10H12N2O4S/c1-11-17(15,16)12-5-4-7-2-3-8(10(13)14)6-9(7)12/h2-3,6,11H,4-5H2,1H3,(H,13,14) |
| InChIKey | ROXFSAKOLSEKRP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |