C11H14N2O3S — CID 53160438
N-methyl-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide (PubChem CID 53160438) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-methyl-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide.
| Compound Name | N-methyl-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 53160438 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-methyl-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)N(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C11H14N2O3S/c1-12-11(14)9-4-3-8-5-6-13(10(8)7-9)17(2,15)16/h3-4,7H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | XBHUTPUDSVHJTI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |