C22H28N4O3S — CID 53160452
N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide (PubChem CID 53160452) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 53160452 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-methylsulfonyl-2,3-dihydroindole-6-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)c3ccc4c(c3)N(S(C)(=O)=O)CC4)cc2)CC1 |
| InChI | InChI=1S/C22H28N4O3S/c1-24-11-13-25(14-12-24)20-7-3-17(4-8-20)16-23-22(27)19-6-5-18-9-10-26(21(18)15-19)30(2,28)29/h3-8,15H,9-14,16H2,1-2H3,(H,23,27) |
| InChIKey | VCLXVFAIOZSGLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|