C23H28N4O2 — CID 50944989
N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 50944989) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 50944989 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)c3ccc(N4CCCC4=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-25-13-15-26(16-14-25)20-8-4-18(5-9-20)17-24-23(29)19-6-10-21(11-7-19)27-12-2-3-22(27)28/h4-11H,2-3,12-17H2,1H3,(H,24,29) |
| InChIKey | VSUKOWCQLZSCEK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|