C14H18N2O5S — CID 146077431
1-(1,4-oxazepan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxylic acid (PubChem CID 146077431) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-(1,4-oxazepan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxylic acid.
| Compound Name | 1-(1,4-oxazepan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxylic acid |
|---|---|
| PubChem CID | 146077431 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(1,4-oxazepan-4-ylsulfonyl)-2,3-dihydroindole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)N(S(=O)(=O)N1CCCOCC1)CC2 |
| InChI | InChI=1S/C14H18N2O5S/c17-14(18)12-3-2-11-4-6-16(13(11)10-12)22(19,20)15-5-1-8-21-9-7-15/h2-3,10H,1,4-9H2,(H,17,18) |
| InChIKey | KUODPXGZXNFKOX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |