C18H16N2O2 — CID 43823655
(6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1-benzofuran-2-yl)methanone (PubChem CID 43823655) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1-benzofuran-2-yl)methanone.
| Compound Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 43823655 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1-benzofuran-2-yl)methanone |
| SMILES | Nc1ccc2c(c1)CCCN2C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H16N2O2/c19-14-7-8-15-12(10-14)5-3-9-20(15)18(21)17-11-13-4-1-2-6-16(13)22-17/h1-2,4,6-8,10-11H,3,5,9,19H2 |
| InChIKey | SDNVSQJDEVIIIH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|