C14H18N2O3 — CID 55119994
(6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1,4-dioxan-2-yl)methanone (PubChem CID 55119994) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 55119994 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (6-amino-3,4-dihydro-2H-quinolin-1-yl)-(1,4-dioxan-2-yl)methanone |
| SMILES | Nc1ccc2c(c1)CCCN2C(=O)C1COCCO1 |
| InChI | InChI=1S/C14H18N2O3/c15-11-3-4-12-10(8-11)2-1-5-16(12)14(17)13-9-18-6-7-19-13/h3-4,8,13H,1-2,5-7,9,15H2 |
| InChIKey | OILHMKPNGBYTFF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|