C23H17ClF2N2O2 — CID 72721993
5-[1-(2-chloro-6-fluorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-2-fluorobenzamide (PubChem CID 72721993) has the molecular formula C23H17ClF2N2O2 and a molecular weight of 426.85 g/mol. Its IUPAC name is 5-[1-(2-chloro-6-fluorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-2-fluorobenzamide.
| Compound Name | 5-[1-(2-chloro-6-fluorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 72721993 |
| Molecular Formula | C23H17ClF2N2O2 |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 5-[1-(2-chloro-6-fluorobenzoyl)-3,4-dihydro-2H-quinolin-6-yl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2ccc3c(c2)CCCN3C(=O)c2c(F)cccc2Cl)ccc1F |
| InChI | InChI=1S/C23H17ClF2N2O2/c24-17-4-1-5-19(26)21(17)23(30)28-10-2-3-15-11-13(7-9-20(15)28)14-6-8-18(25)16(12-14)22(27)29/h1,4-9,11-12H,2-3,10H2,(H2,27,29) |
| InChIKey | YOLLUTSUMZFIIN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |