C18H17F6NO3S — CID 20704026
2-(1-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 20704026) has the molecular formula C18H17F6NO3S and a molecular weight of 441.39 g/mol. Its IUPAC name is 2-(1-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(1-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 20704026 |
| Molecular Formula | C18H17F6NO3S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-(1-cyclohexa-2,4-dien-1-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(C1C=CC=CC1)N1CCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H17F6NO3S/c19-17(20,21)16(26,18(22,23)24)13-8-9-15-12(11-13)5-4-10-25(15)29(27,28)14-6-2-1-3-7-14/h1-3,6,8-9,11,14,26H,4-5,7,10H2 |
| InChIKey | WQNKNJQGVINDMJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |