C19H16F7NO3S — CID 123213278
1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol (PubChem CID 123213278) has the molecular formula C19H16F7NO3S and a molecular weight of 471.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 123213278 |
| Molecular Formula | C19H16F7NO3S |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol |
| SMILES | CC1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F7NO3S/c1-11-2-3-12-10-13(17(28,18(21,22)23)19(24,25)26)4-9-16(12)27(11)31(29,30)15-7-5-14(20)6-8-15/h4-11,28H,2-3H2,1H3 |
| InChIKey | IJYKLHCHXPGHHA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |