C25H25F7N2O5S — CID 162248661
5-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N,N-dimethyl-4-oxopentanamide (PubChem CID 162248661) has the molecular formula C25H25F7N2O5S and a molecular weight of 598.54 g/mol. Its IUPAC name is 5-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N,N-dimethyl-4-oxopentanamide.
| Compound Name | 5-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N,N-dimethyl-4-oxopentanamide |
|---|---|
| PubChem CID | 162248661 |
| Molecular Formula | C25H25F7N2O5S |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 5-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N,N-dimethyl-4-oxopentanamide |
| SMILES | CN(C)C(=O)CCC(=O)C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25F7N2O5S/c1-33(2)22(36)12-8-19(35)14-18-7-3-15-13-16(23(37,24(27,28)29)25(30,31)32)4-11-21(15)34(18)40(38,39)20-9-5-17(26)6-10-20/h4-6,9-11,13,18,37H,3,7-8,12,14H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZXRMSWUZRZXFDY-SFHVURJKSA-N |
| XLogP | 4.48 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |