C25H24F8N2O4S — CID 123641322
1-[3-(fluoromethyl)pyrrolidin-1-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]ethanone (PubChem CID 123641322) has the molecular formula C25H24F8N2O4S and a molecular weight of 600.53 g/mol. Its IUPAC name is 1-[3-(fluoromethyl)pyrrolidin-1-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]ethanone.
| Compound Name | 1-[3-(fluoromethyl)pyrrolidin-1-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 123641322 |
| Molecular Formula | C25H24F8N2O4S |
| Molecular Weight | 600.53 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 1-[3-(fluoromethyl)pyrrolidin-1-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]ethanone |
| SMILES | O=C(CC1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)N1CCC(CF)C1 |
| InChI | InChI=1S/C25H24F8N2O4S/c26-13-15-9-10-34(14-15)22(36)12-19-5-1-16-11-17(23(37,24(28,29)30)25(31,32)33)2-8-21(16)35(19)40(38,39)20-6-3-18(27)4-7-20/h2-4,6-8,11,15,19,37H,1,5,9-10,12-14H2 |
| InChIKey | DEIHDBGOUSQHOI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |