C32H28F7N3O4S — CID 122660497
2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]ethanone (PubChem CID 122660497) has the molecular formula C32H28F7N3O4S and a molecular weight of 683.65 g/mol. Its IUPAC name is 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 122660497 |
| Molecular Formula | C32H28F7N3O4S |
| Molecular Weight | 683.65 g/mol |
| Exact Mass | 683.17 |
| IUPAC Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-1-[3-(1H-indol-3-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)N1CCC(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C32H28F7N3O4S/c33-22-7-10-24(11-8-22)47(45,46)42-23(9-5-19-15-21(6-12-28(19)42)30(44,31(34,35)36)32(37,38)39)16-29(43)41-14-13-20(18-41)26-17-40-27-4-2-1-3-25(26)27/h1-4,6-8,10-12,15,17,20,23,40,44H,5,9,13-14,16,18H2/t20?,23-/m0/s1 |
| InChIKey | JVKGRGWTUVKJCU-AKRCKQFNSA-N |
| XLogP | 6.54 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |