C33H30F7N3O5S — CID 129166400
2-[1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]piperidin-4-yl]-3H-isoindol-1-one (PubChem CID 129166400) has the molecular formula C33H30F7N3O5S and a molecular weight of 713.67 g/mol. Its IUPAC name is 2-[1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]piperidin-4-yl]-3H-isoindol-1-one.
| Compound Name | 2-[1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]piperidin-4-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 129166400 |
| Molecular Formula | C33H30F7N3O5S |
| Molecular Weight | 713.67 g/mol |
| Exact Mass | 713.18 |
| IUPAC Name | 2-[1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]piperidin-4-yl]-3H-isoindol-1-one |
| SMILES | O=C(C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)N1CCC(N2Cc3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C33H30F7N3O5S/c34-23-7-10-26(11-8-23)49(47,48)43-25(9-5-20-17-22(6-12-28(20)43)31(46,32(35,36)37)33(38,39)40)18-29(44)41-15-13-24(14-16-41)42-19-21-3-1-2-4-27(21)30(42)45/h1-4,6-8,10-12,17,24-25,46H,5,9,13-16,18-19H2/t25-/m0/s1 |
| InChIKey | VZQQOTDRIONYDF-VWLOTQADSA-N |
| XLogP | 5.69 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |