C27H25F7N4O6S — CID 122652504
8-[2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 122652504) has the molecular formula C27H25F7N4O6S and a molecular weight of 666.57 g/mol. Its IUPAC name is 8-[2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 122652504 |
| Molecular Formula | C27H25F7N4O6S |
| Molecular Weight | 666.57 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | 8-[2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)CC3CCc4cc(C(O)(C(F)(F)F)C(F)(F)F)ccc4N3S(=O)(=O)c3ccc(F)cc3)CC2)N1 |
| InChI | InChI=1S/C27H25F7N4O6S/c28-17-3-6-19(7-4-17)45(43,44)38-18(14-21(39)37-11-9-24(10-12-37)22(40)35-23(41)36-24)5-1-15-13-16(2-8-20(15)38)25(42,26(29,30)31)27(32,33)34/h2-4,6-8,13,18,42H,1,5,9-12,14H2,(H2,35,36,40,41) |
| InChIKey | KNWUZYSNKFGSBP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|