C26H26F7NO5S — CID 153242825
1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxan-4-yl)propan-2-one (PubChem CID 153242825) has the molecular formula C26H26F7NO5S and a molecular weight of 597.55 g/mol. Its IUPAC name is 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxan-4-yl)propan-2-one.
| Compound Name | 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxan-4-yl)propan-2-one |
|---|---|
| PubChem CID | 153242825 |
| Molecular Formula | C26H26F7NO5S |
| Molecular Weight | 597.55 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxan-4-yl)propan-2-one |
| SMILES | O=C(CC1CCOCC1)C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F7NO5S/c27-19-3-6-22(7-4-19)40(37,38)34-20(15-21(35)13-16-9-11-39-12-10-16)5-1-17-14-18(2-8-23(17)34)24(36,25(28,29)30)26(31,32)33/h2-4,6-8,14,16,20,36H,1,5,9-13,15H2/t20-/m0/s1 |
| InChIKey | WRTXQJJQMCJLCE-FQEVSTJZSA-N |
| XLogP | 5.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |