C25H25F7N2O6S — CID 122662366
N-[(3S,4R)-3,4-dihydroxycyclopentyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 122662366) has the molecular formula C25H25F7N2O6S and a molecular weight of 614.54 g/mol. Its IUPAC name is N-[(3S,4R)-3,4-dihydroxycyclopentyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-[(3S,4R)-3,4-dihydroxycyclopentyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 122662366 |
| Molecular Formula | C25H25F7N2O6S |
| Molecular Weight | 614.54 g/mol |
| Exact Mass | 614.13 |
| IUPAC Name | N-[(3S,4R)-3,4-dihydroxycyclopentyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)NC1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C25H25F7N2O6S/c26-15-3-6-18(7-4-15)41(39,40)34-17(12-22(37)33-16-10-20(35)21(36)11-16)5-1-13-9-14(2-8-19(13)34)23(38,24(27,28)29)25(30,31)32/h2-4,6-9,16-17,20-21,35-36,38H,1,5,10-12H2,(H,33,37)/t16?,17-,20-,21+/m0/s1 |
| InChIKey | FKUZHQCAPZAYRG-IXZQFDRKSA-N |
| XLogP | 3.04 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |