C21H17F7N2O4S — CID 144805050
2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-methylideneacetamide (PubChem CID 144805050) has the molecular formula C21H17F7N2O4S and a molecular weight of 526.43 g/mol. Its IUPAC name is 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-methylideneacetamide.
| Compound Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-methylideneacetamide |
|---|---|
| PubChem CID | 144805050 |
| Molecular Formula | C21H17F7N2O4S |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-methylideneacetamide |
| SMILES | C=NC(=O)C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17F7N2O4S/c1-29-18(31)11-15-6-2-12-10-13(19(32,20(23,24)25)21(26,27)28)3-9-17(12)30(15)35(33,34)16-7-4-14(22)5-8-16/h3-5,7-10,15,32H,1-2,6,11H2/t15-/m0/s1 |
| InChIKey | RCGHYNWZXMKDRH-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|