C25H24F7NO5S — CID 161334591
1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxolan-3-yl)propan-2-one (PubChem CID 161334591) has the molecular formula C25H24F7NO5S and a molecular weight of 583.52 g/mol. Its IUPAC name is 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxolan-3-yl)propan-2-one.
| Compound Name | 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxolan-3-yl)propan-2-one |
|---|---|
| PubChem CID | 161334591 |
| Molecular Formula | C25H24F7NO5S |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 1-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-3-(oxolan-3-yl)propan-2-one |
| SMILES | O=C(CC1CCOC1)C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24F7NO5S/c26-18-3-6-21(7-4-18)39(36,37)33-19(13-20(34)11-15-9-10-38-14-15)5-1-16-12-17(2-8-22(16)33)23(35,24(27,28)29)25(30,31)32/h2-4,6-8,12,15,19,35H,1,5,9-11,13-14H2/t15?,19-/m0/s1 |
| InChIKey | VLVZGHVLPUQKGA-FUBQLUNQSA-N |
| XLogP | 5.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |