C26H28F6N2O5S — CID 123607184
N-[[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl]oxane-4-carboxamide (PubChem CID 123607184) has the molecular formula C26H28F6N2O5S and a molecular weight of 594.57 g/mol. Its IUPAC name is N-[[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 123607184 |
| Molecular Formula | C26H28F6N2O5S |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | N-[[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]methyl]oxane-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3CCC2CNC(=O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28F6N2O5S/c1-16-2-7-21(8-3-16)40(37,38)34-20(15-33-23(35)17-10-12-39-13-11-17)6-4-18-14-19(5-9-22(18)34)24(36,25(27,28)29)26(30,31)32/h2-3,5,7-9,14,17,20,36H,4,6,10-13,15H2,1H3,(H,33,35) |
| InChIKey | XWRMPBZGLOFWQF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |