C26H26F6N2O6S — CID 123466318
2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]-N-(4-oxooxan-3-yl)acetamide (PubChem CID 123466318) has the molecular formula C26H26F6N2O6S and a molecular weight of 608.56 g/mol. Its IUPAC name is 2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]-N-(4-oxooxan-3-yl)acetamide.
| Compound Name | 2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]-N-(4-oxooxan-3-yl)acetamide |
|---|---|
| PubChem CID | 123466318 |
| Molecular Formula | C26H26F6N2O6S |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]-N-(4-oxooxan-3-yl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3CCC2CC(=O)NC2COCCC2=O)cc1 |
| InChI | InChI=1S/C26H26F6N2O6S/c1-15-2-7-19(8-3-15)41(38,39)34-18(13-23(36)33-20-14-40-11-10-22(20)35)6-4-16-12-17(5-9-21(16)34)24(37,25(27,28)29)26(30,31)32/h2-3,5,7-9,12,18,20,37H,4,6,10-11,13-14H2,1H3,(H,33,36) |
| InChIKey | TZRXAQWNORYHRM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |