C23H24F5NO4S — CID 162595348
1-[(2S)-1-(4-methylphenyl)sulfonyl-6-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]propan-2-one (PubChem CID 162595348) has the molecular formula C23H24F5NO4S and a molecular weight of 505.51 g/mol. Its IUPAC name is 1-[(2S)-1-(4-methylphenyl)sulfonyl-6-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]propan-2-one.
| Compound Name | 1-[(2S)-1-(4-methylphenyl)sulfonyl-6-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 162595348 |
| Molecular Formula | C23H24F5NO4S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1-[(2S)-1-(4-methylphenyl)sulfonyl-6-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1CCc2cc(C(O)(C(C)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24F5NO4S/c1-14-4-9-19(10-5-14)34(32,33)29-18(12-15(2)30)8-6-16-13-17(7-11-20(16)29)22(31,21(3,24)25)23(26,27)28/h4-5,7,9-11,13,18,31H,6,8,12H2,1-3H3/t18-,22?/m0/s1 |
| InChIKey | HUXXAUZCRUNHPC-HXBUSHRASA-N |
| XLogP | 4.89 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |