C27H28F6N2O6S — CID 123322044
N-(4,4-dimethyl-5-oxooxolan-3-yl)-2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 123322044) has the molecular formula C27H28F6N2O6S and a molecular weight of 622.58 g/mol. Its IUPAC name is N-(4,4-dimethyl-5-oxooxolan-3-yl)-2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-(4,4-dimethyl-5-oxooxolan-3-yl)-2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 123322044 |
| Molecular Formula | C27H28F6N2O6S |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | N-(4,4-dimethyl-5-oxooxolan-3-yl)-2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3CCC2CC(=O)NC2COC(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C27H28F6N2O6S/c1-15-4-9-19(10-5-15)42(39,40)35-18(13-22(36)34-21-14-41-23(37)24(21,2)3)8-6-16-12-17(7-11-20(16)35)25(38,26(28,29)30)27(31,32)33/h4-5,7,9-12,18,21,38H,6,8,13-14H2,1-3H3,(H,34,36) |
| InChIKey | PEZUFUNNWQJOLD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |