C28H32F6N2O4S — CID 144805163
N-[[(2S)-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-quinolin-2-yl]methyl]-4-methoxycyclohexane-1-carboxamide (PubChem CID 144805163) has the molecular formula C28H32F6N2O4S and a molecular weight of 606.63 g/mol. Its IUPAC name is N-[[(2S)-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-quinolin-2-yl]methyl]-4-methoxycyclohexane-1-carboxamide.
| Compound Name | N-[[(2S)-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-quinolin-2-yl]methyl]-4-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 144805163 |
| Molecular Formula | C28H32F6N2O4S |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | N-[[(2S)-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-quinolin-2-yl]methyl]-4-methoxycyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)NC[C@@H]2CCc3cc(C(O)(C(F)(F)F)C(F)(F)F)ccc3N2S(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C28H32F6N2O4S/c1-17-3-12-23(13-4-17)41(39)36-21(16-35-25(37)18-6-10-22(40-2)11-7-18)9-5-19-15-20(8-14-24(19)36)26(38,27(29,30)31)28(32,33)34/h3-4,8,12-15,18,21-22,38H,5-7,9-11,16H2,1-2H3,(H,35,37)/t18?,21-,22?,41?/m0/s1 |
| InChIKey | KFAQGXHEPJWPCZ-PZVWVVKHSA-N |
| XLogP | 5.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |