C23H23F7N2O4S — CID 144805076
2-[1-(4-fluorophenyl)sulfinyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(3-hydroxypropyl)acetamide (PubChem CID 144805076) has the molecular formula C23H23F7N2O4S and a molecular weight of 556.50 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)sulfinyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-[1-(4-fluorophenyl)sulfinyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 144805076 |
| Molecular Formula | C23H23F7N2O4S |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-[1-(4-fluorophenyl)sulfinyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(CC1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)c1ccc(F)cc1)NCCCO |
| InChI | InChI=1S/C23H23F7N2O4S/c24-16-4-7-18(8-5-16)37(36)32-17(13-20(34)31-10-1-11-33)6-2-14-12-15(3-9-19(14)32)21(35,22(25,26)27)23(28,29)30/h3-5,7-9,12,17,33,35H,1-2,6,10-11,13H2,(H,31,34) |
| InChIKey | ZWELFHMMWGBFQC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|