C28H22F7N3O4S2 — CID 123147976
N-(1,3-benzothiazol-2-ylmethyl)-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 123147976) has the molecular formula C28H22F7N3O4S2 and a molecular weight of 661.62 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 123147976 |
| Molecular Formula | C28H22F7N3O4S2 |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | O=C(CC1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H22F7N3O4S2/c29-18-7-10-20(11-8-18)44(41,42)38-19(14-24(39)36-15-25-37-21-3-1-2-4-23(21)43-25)9-5-16-13-17(6-12-22(16)38)26(40,27(30,31)32)28(33,34)35/h1-4,6-8,10-13,19,40H,5,9,14-15H2,(H,36,39) |
| InChIKey | YIKLLLFGZQYTTL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |