C32H34F7N3O4S — CID 123680192
N-[2-(2-tert-butyl-4-pyridinyl)propan-2-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 123680192) has the molecular formula C32H34F7N3O4S and a molecular weight of 689.69 g/mol. Its IUPAC name is N-[2-(2-tert-butyl-4-pyridinyl)propan-2-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-[2-(2-tert-butyl-4-pyridinyl)propan-2-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 123680192 |
| Molecular Formula | C32H34F7N3O4S |
| Molecular Weight | 689.69 g/mol |
| Exact Mass | 689.22 |
| IUPAC Name | N-[2-(2-tert-butyl-4-pyridinyl)propan-2-yl]-2-[1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)NC(=O)CC2CCc3cc(C(O)(C(F)(F)F)C(F)(F)F)ccc3N2S(=O)(=O)c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C32H34F7N3O4S/c1-28(2,3)26-17-20(14-15-40-26)29(4,5)41-27(43)18-23-10-6-19-16-21(30(44,31(34,35)36)32(37,38)39)7-13-25(19)42(23)47(45,46)24-11-8-22(33)9-12-24/h7-9,11-17,23,44H,6,10,18H2,1-5H3,(H,41,43) |
| InChIKey | VYSJJVPXTKUTIK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |