C26H20F7N3O6S — CID 122662305
3-[[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]amino]pyridine-2-carboxylic acid (PubChem CID 122662305) has the molecular formula C26H20F7N3O6S and a molecular weight of 635.51 g/mol. Its IUPAC name is 3-[[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 3-[[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122662305 |
| Molecular Formula | C26H20F7N3O6S |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | 3-[[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]amino]pyridine-2-carboxylic acid |
| SMILES | O=C(C[C@@H]1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C26H20F7N3O6S/c27-16-5-8-18(9-6-16)43(41,42)36-17(13-21(37)35-19-2-1-11-34-22(19)23(38)39)7-3-14-12-15(4-10-20(14)36)24(40,25(28,29)30)26(31,32)33/h1-2,4-6,8-12,17,40H,3,7,13H2,(H,35,37)(H,38,39)/t17-/m0/s1 |
| InChIKey | ZPGATDMQGOXSRW-KRWDZBQOSA-N |
| XLogP | 4.77 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |