C28H31F7N2O5S — CID 144805146
acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-[(2-methyloxolan-2-yl)methyl]acetamide (PubChem CID 144805146) has the molecular formula C28H31F7N2O5S and a molecular weight of 640.62 g/mol. Its IUPAC name is acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-[(2-methyloxolan-2-yl)methyl]acetamide.
| Compound Name | acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-[(2-methyloxolan-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 144805146 |
| Molecular Formula | C28H31F7N2O5S |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | acetylene;1,1,1,3,3,3-hexafluoro-2-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]propan-2-ol;N-[(2-methyloxolan-2-yl)methyl]acetamide |
| SMILES | C#C.CC(=O)NCC1(C)CCCO1.O=S(=O)(c1ccc(F)cc1)N1CCCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H14F7NO3S.C8H15NO2.C2H2/c19-13-4-6-14(7-5-13)30(28,29)26-9-1-2-11-10-12(3-8-15(11)26)16(27,17(20,21)22)18(23,24)25;1-7(10)9-6-8(2)4-3-5-11-8;1-2/h3-8,10,27H,1-2,9H2;3-6H2,1-2H3,(H,9,10);1-2H |
| InChIKey | MNFWLSJSYYNCLV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|