C22H25BF3NO4S — CID 123371401
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 123371401) has the molecular formula C22H25BF3NO4S and a molecular weight of 467.32 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 123371401 |
| Molecular Formula | C22H25BF3NO4S |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCCN3S(=O)(=O)c2ccc(C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C22H25BF3NO4S/c1-20(2)21(3,4)31-23(30-20)17-9-12-19-15(14-17)6-5-13-27(19)32(28,29)18-10-7-16(8-11-18)22(24,25)26/h7-12,14H,5-6,13H2,1-4H3 |
| InChIKey | BVEJXMSOKFBAAS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|