C21H20N2O2S — CID 118714841
1-(4-methylphenyl)sulfonyl-6-pyridin-3-yl-3,4-dihydro-2H-quinoline (PubChem CID 118714841) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-6-pyridin-3-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-methylphenyl)sulfonyl-6-pyridin-3-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 118714841 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-6-pyridin-3-yl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCc3cc(-c4cccnc4)ccc32)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-16-6-9-20(10-7-16)26(24,25)23-13-3-5-18-14-17(8-11-21(18)23)19-4-2-12-22-15-19/h2,4,6-12,14-15H,3,5,13H2,1H3 |
| InChIKey | YKKMRLZEHVPJLV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |