C25H22N2O4S — CID 1250744
2-[[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]methyl]isoindole-1,3-dione (PubChem CID 1250744) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1250744 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCc3cc(CN4C(=O)c5ccccc5C4=O)ccc32)cc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-17-8-11-20(12-9-17)32(30,31)27-14-4-5-19-15-18(10-13-23(19)27)16-26-24(28)21-6-2-3-7-22(21)25(26)29/h2-3,6-13,15H,4-5,14,16H2,1H3 |
| InChIKey | IYPHZFWVXWFIBD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|