C25H20FN3O5S — CID 27567804
2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]acetamide (PubChem CID 27567804) has the molecular formula C25H20FN3O5S and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 27567804 |
| Molecular Formula | C25H20FN3O5S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-6-yl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20FN3O5S/c26-17-7-10-19(11-8-17)35(33,34)29-13-3-4-16-14-18(9-12-22(16)29)27-23(30)15-28-24(31)20-5-1-2-6-21(20)25(28)32/h1-2,5-12,14H,3-4,13,15H2,(H,27,30) |
| InChIKey | DNNJGAOGCNLHBS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|