C15H17N3O2S — CID 62150985
3-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]pyridin-2-amine (PubChem CID 62150985) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]pyridin-2-amine.
| Compound Name | 3-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62150985 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]pyridin-2-amine |
| SMILES | Cc1ccc2c(c1)CCCN2S(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C15H17N3O2S/c1-11-6-7-13-12(10-11)4-3-9-18(13)21(19,20)14-5-2-8-17-15(14)16/h2,5-8,10H,3-4,9H2,1H3,(H2,16,17) |
| InChIKey | VXUDWCGTJSXDKQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |