C13H16N4O2S — CID 62374780
1-(1-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 62374780) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(1-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | 1-(1-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 62374780 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(1-methylimidazol-4-yl)sulfonyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2CCCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C13H16N4O2S/c1-16-8-13(15-9-16)20(18,19)17-6-2-3-10-7-11(14)4-5-12(10)17/h4-5,7-9H,2-3,6,14H2,1H3 |
| InChIKey | PXSNDRLVGYGCRS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|