C12H13N3O2S2 — CID 103413778
1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3-dihydroindol-5-amine (PubChem CID 103413778) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3-dihydroindol-5-amine.
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 103413778 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-2,3-dihydroindol-5-amine |
| SMILES | Cc1ncc(S(=O)(=O)N2CCc3cc(N)ccc32)s1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-8-14-7-12(18-8)19(16,17)15-5-4-9-6-10(13)2-3-11(9)15/h2-3,6-7H,4-5,13H2,1H3 |
| InChIKey | WGUSEANUYFJEGW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|