About 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine
1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 28707117) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine |
| PubChem CID | 28707117 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3ccc(N)cc32)c(C)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-3-6-16(12(2)9-11)21(19,20)18-8-7-13-4-5-14(17)10-15(13)18/h3-6,9-10H,7-8,17H2,1-2H3 |
| InChIKey | YTBRCNWWEMCSRV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine?
The IUPAC name of 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine (CID 28707117) is 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine.
What is the SMILES notation for 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine?
The canonical SMILES for 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine is Cc1ccc(S(=O)(=O)N2CCc3ccc(N)cc32)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine?
The InChIKey is YTBRCNWWEMCSRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-11-3-6-16(12(2)9-11)21(19,20)18-8-7-13-4-5-14(17)10-15(13)18/h3-6,9-10H,7-8,17H2,1-2H3.
What are the key properties of 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine?
1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine has a molecular weight of 302.40 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)sulfonyl-2,3-dihydroindol-6-amine is sourced from PubChem (CID 28707117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).