C11H12BrN5O2S — CID 106465446
1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 106465446) has the molecular formula C11H12BrN5O2S and a molecular weight of 358.22 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3-dihydroindol-6-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 106465446 |
| Molecular Formula | C11H12BrN5O2S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)N1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H12BrN5O2S/c1-16-11(10(12)14-15-16)20(18,19)17-5-4-7-2-3-8(13)6-9(7)17/h2-3,6H,4-5,13H2,1H3 |
| InChIKey | BXDFRKBSTYRDII-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|