C13H13ClN2O2S2 — CID 103099496
1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 103099496) has the molecular formula C13H13ClN2O2S2 and a molecular weight of 328.85 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 103099496 |
| Molecular Formula | C13H13ClN2O2S2 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Cc1cc(S(=O)(=O)N2CCc3ccc(N)cc32)sc1Cl |
| InChI | InChI=1S/C13H13ClN2O2S2/c1-8-6-12(19-13(8)14)20(17,18)16-5-4-9-2-3-10(15)7-11(9)16/h2-3,6-7H,4-5,15H2,1H3 |
| InChIKey | YAKNNXPCRBUCNN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|