C12H10BrClN2O2S2 — CID 80578213
1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 80578213) has the molecular formula C12H10BrClN2O2S2 and a molecular weight of 393.72 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 80578213 |
| Molecular Formula | C12H10BrClN2O2S2 |
| Molecular Weight | 393.72 g/mol |
| Exact Mass | 391.91 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)c1cc(Cl)c(Br)s1)CC2 |
| InChI | InChI=1S/C12H10BrClN2O2S2/c13-12-9(14)6-11(19-12)20(17,18)16-4-3-7-1-2-8(15)5-10(7)16/h1-2,5-6H,3-4,15H2 |
| InChIKey | ZFGGSHNOGJDQKW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|