C13H18N2O4S2 — CID 62083870
1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 62083870) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 62083870 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)C1CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C13H18N2O4S2/c14-11-2-1-10-3-6-15(13(10)9-11)21(18,19)12-4-7-20(16,17)8-5-12/h1-2,9,12H,3-8,14H2 |
| InChIKey | SYXTYBWLLFVLRW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|