About 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine
1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine (PubChem CID 62083870) has the molecular formula C13H18N2O4S2
and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
| PubChem CID | 62083870 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)C1CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C13H18N2O4S2/c14-11-2-1-10-3-6-15(13(10)9-11)21(18,19)12-4-7-20(16,17)8-5-12/h1-2,9,12H,3-8,14H2 |
| InChIKey | SYXTYBWLLFVLRW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine?
The IUPAC name of 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine (CID 62083870) is 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine.
What is the SMILES notation for 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine?
The canonical SMILES for 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine is Nc1ccc2c(c1)N(S(=O)(=O)C1CCS(=O)(=O)CC1)CC2.
What is the InChIKey of 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine?
The InChIKey is SYXTYBWLLFVLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S2/c14-11-2-1-10-3-6-15(13(10)9-11)21(18,19)12-4-7-20(16,17)8-5-12/h1-2,9,12H,3-8,14H2.
What are the key properties of 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine?
1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine has a molecular weight of 330.43 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-4-yl)sulfonyl-2,3-dihydroindol-6-amine is sourced from PubChem (CID 62083870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).