C10H12BrN5O3S — CID 106465490
N-[(5-amino-2-hydroxyphenyl)methyl]-5-bromo-3-methyltriazole-4-sulfonamide (PubChem CID 106465490) has the molecular formula C10H12BrN5O3S and a molecular weight of 362.21 g/mol. Its IUPAC name is N-[(5-amino-2-hydroxyphenyl)methyl]-5-bromo-3-methyltriazole-4-sulfonamide.
| Compound Name | N-[(5-amino-2-hydroxyphenyl)methyl]-5-bromo-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106465490 |
| Molecular Formula | C10H12BrN5O3S |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | N-[(5-amino-2-hydroxyphenyl)methyl]-5-bromo-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCc1cc(N)ccc1O |
| InChI | InChI=1S/C10H12BrN5O3S/c1-16-10(9(11)14-15-16)20(18,19)13-5-6-4-7(12)2-3-8(6)17/h2-4,13,17H,5,12H2,1H3 |
| InChIKey | ARYBAVULOIACNI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|