C8H10BrN5O4S3 — CID 106466786
5-bromo-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]triazole-4-sulfonamide (PubChem CID 106466786) has the molecular formula C8H10BrN5O4S3 and a molecular weight of 416.30 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106466786 |
| Molecular Formula | C8H10BrN5O4S3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 5-bromo-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C8H10BrN5O4S3/c1-14-8(7(9)12-13-14)21(17,18)11-4-5-2-3-6(19-5)20(10,15)16/h2-3,11H,4H2,1H3,(H2,10,15,16) |
| InChIKey | RXRNKZTYKGSACF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |