C12H11N3O4S3 — CID 26947458
5-[[(4-cyanophenyl)sulfonylamino]methyl]thiophene-2-sulfonamide (PubChem CID 26947458) has the molecular formula C12H11N3O4S3 and a molecular weight of 357.44 g/mol. Its IUPAC name is 5-[[(4-cyanophenyl)sulfonylamino]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-[[(4-cyanophenyl)sulfonylamino]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26947458 |
| Molecular Formula | C12H11N3O4S3 |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 5-[[(4-cyanophenyl)sulfonylamino]methyl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCc2ccc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C12H11N3O4S3/c13-7-9-1-4-11(5-2-9)22(18,19)15-8-10-3-6-12(20-10)21(14,16)17/h1-6,15H,8H2,(H2,14,16,17) |
| InChIKey | ANCXRUUEVKIOCG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |