C5H10BrN5O4S2 — CID 106467356
5-bromo-3-methyl-N-(2-sulfamoylethyl)triazole-4-sulfonamide (PubChem CID 106467356) has the molecular formula C5H10BrN5O4S2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(2-sulfamoylethyl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-(2-sulfamoylethyl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106467356 |
| Molecular Formula | C5H10BrN5O4S2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 5-bromo-3-methyl-N-(2-sulfamoylethyl)triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C5H10BrN5O4S2/c1-11-5(4(6)9-10-11)17(14,15)8-2-3-16(7,12)13/h8H,2-3H2,1H3,(H2,7,12,13) |
| InChIKey | NJKPWZYIZZDJBD-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |