C8H15BrN4O2S — CID 106467256
5-bromo-3-methyl-N-(3-methylbutyl)triazole-4-sulfonamide (PubChem CID 106467256) has the molecular formula C8H15BrN4O2S and a molecular weight of 311.21 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(3-methylbutyl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-(3-methylbutyl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106467256 |
| Molecular Formula | C8H15BrN4O2S |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 5-bromo-3-methyl-N-(3-methylbutyl)triazole-4-sulfonamide |
| SMILES | CC(C)CCNS(=O)(=O)c1c(Br)nnn1C |
| InChI | InChI=1S/C8H15BrN4O2S/c1-6(2)4-5-10-16(14,15)8-7(9)11-12-13(8)3/h6,10H,4-5H2,1-3H3 |
| InChIKey | PCDGOTSYSDHHCP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |