C10H17BrN4O4S — CID 106466045
2-[[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]methyl]-4-methylpentanoic acid (PubChem CID 106466045) has the molecular formula C10H17BrN4O4S and a molecular weight of 369.24 g/mol. Its IUPAC name is 2-[[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 106466045 |
| Molecular Formula | C10H17BrN4O4S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-[[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNS(=O)(=O)c1c(Br)nnn1C)C(=O)O |
| InChI | InChI=1S/C10H17BrN4O4S/c1-6(2)4-7(10(16)17)5-12-20(18,19)9-8(11)13-14-15(9)3/h6-7,12H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | RFWISPNJDXFKON-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |