C9H13BrN4O6S — CID 107823966
(2R)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107823966) has the molecular formula C9H13BrN4O6S and a molecular weight of 385.20 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107823966 |
| Molecular Formula | C9H13BrN4O6S |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | (2R)-2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NS(=O)(=O)c1c(Br)nnn1C)C(=O)O |
| InChI | InChI=1S/C9H13BrN4O6S/c1-14-8(7(10)11-13-14)21(18,19)12-5(9(16)17)3-4-6(15)20-2/h5,12H,3-4H2,1-2H3,(H,16,17)/t5-/m1/s1 |
| InChIKey | OEVVXFCRUMVQLD-RXMQYKEDSA-N |
| XLogP | -0.74 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |