C11H11BrN4O4S — CID 106465632
2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-2-phenylacetic acid (PubChem CID 106465632) has the molecular formula C11H11BrN4O4S and a molecular weight of 375.20 g/mol. Its IUPAC name is 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-2-phenylacetic acid.
| Compound Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 106465632 |
| Molecular Formula | C11H11BrN4O4S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-2-phenylacetic acid |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H11BrN4O4S/c1-16-10(9(12)13-15-16)21(19,20)14-8(11(17)18)7-5-3-2-4-6-7/h2-6,8,14H,1H3,(H,17,18) |
| InChIKey | FPBCQPGMCGNMCJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |